C10H28O4Si4 — CID 123389963
2,4,6,8-tetramethyl-2,6-dipropyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 123389963) has the molecular formula C10H28O4Si4 and a molecular weight of 324.67 g/mol. Its IUPAC name is 2,4,6,8-tetramethyl-2,6-dipropyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,4,6,8-tetramethyl-2,6-dipropyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 123389963 |
| Molecular Formula | C10H28O4Si4 |
| Molecular Weight | 324.67 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 2,4,6,8-tetramethyl-2,6-dipropyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CCC[Si]1(C)O[SiH](C)O[Si](C)(CCC)O[SiH](C)O1 |
| InChI | InChI=1S/C10H28O4Si4/c1-7-9-17(5)11-15(3)13-18(6,10-8-2)14-16(4)12-17/h15-16H,7-10H2,1-6H3 |
| InChIKey | QTIRJFIIOLSBBA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.67 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|