C6H15Cl3O3Si3 — CID 150465628
2,4,6-trimethyl-2-(3,3,3-trichloropropyl)-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 150465628) has the molecular formula C6H15Cl3O3Si3 and a molecular weight of 325.80 g/mol. Its IUPAC name is 2,4,6-trimethyl-2-(3,3,3-trichloropropyl)-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2,4,6-trimethyl-2-(3,3,3-trichloropropyl)-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 150465628 |
| Molecular Formula | C6H15Cl3O3Si3 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 323.94 |
| IUPAC Name | 2,4,6-trimethyl-2-(3,3,3-trichloropropyl)-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | C[SiH]1O[SiH](C)O[Si](C)(CCC(Cl)(Cl)Cl)O1 |
| InChI | InChI=1S/C6H15Cl3O3Si3/c1-13-10-14(2)12-15(3,11-13)5-4-6(7,8)9/h13-14H,4-5H2,1-3H3 |
| InChIKey | HQRZBQSZSBSPNJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|