C18H29O4PSi4 — CID 151790292
diphenyl-[2-(2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethyl]phosphane (PubChem CID 151790292) has the molecular formula C18H29O4PSi4 and a molecular weight of 452.74 g/mol. Its IUPAC name is diphenyl-[2-(2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethyl]phosphane.
| Compound Name | diphenyl-[2-(2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethyl]phosphane |
|---|---|
| PubChem CID | 151790292 |
| Molecular Formula | C18H29O4PSi4 |
| Molecular Weight | 452.74 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | diphenyl-[2-(2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethyl]phosphane |
| SMILES | C[SiH]1O[SiH](C)O[Si](C)(CCP(c2ccccc2)c2ccccc2)O[SiH](C)O1 |
| InChI | InChI=1S/C18H29O4PSi4/c1-24-19-25(2)21-27(4,22-26(3)20-24)16-15-23(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,24-26H,15-16H2,1-4H3 |
| InChIKey | RWLXWTGEQRZUEF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.74 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|