C11H23NO4Si4 — CID 150448302
N-benzyl-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine (PubChem CID 150448302) has the molecular formula C11H23NO4Si4 and a molecular weight of 345.65 g/mol. Its IUPAC name is N-benzyl-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine.
| Compound Name | N-benzyl-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine |
|---|---|
| PubChem CID | 150448302 |
| Molecular Formula | C11H23NO4Si4 |
| Molecular Weight | 345.65 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | N-benzyl-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine |
| SMILES | C[SiH]1O[SiH](C)O[Si](C)(NCc2ccccc2)O[SiH](C)O1 |
| InChI | InChI=1S/C11H23NO4Si4/c1-17-13-18(2)15-20(4,16-19(3)14-17)12-10-11-8-6-5-7-9-11/h5-9,12,17-19H,10H2,1-4H3 |
| InChIKey | HNFXAHSGAYCEGH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.65 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|