C13H28O4Si4 — CID 58802956
2-[2-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 58802956) has the molecular formula C13H28O4Si4 and a molecular weight of 360.71 g/mol. Its IUPAC name is 2-[2-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2-[2-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 58802956 |
| Molecular Formula | C13H28O4Si4 |
| Molecular Weight | 360.71 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2-[2-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C[SiH]1O[SiH](C)O[Si](C)(CCC2CC3C=CC2C3)O[SiH](C)O1 |
| InChI | InChI=1S/C13H28O4Si4/c1-18-14-19(2)16-21(4,17-20(3)15-18)8-7-13-10-11-5-6-12(13)9-11/h5-6,11-13,18-20H,7-10H2,1-4H3 |
| InChIKey | XHJDQNQCKGBEAA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.71 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|