C7H19F3O4Si4 — CID 154128105
2,4,6,8-tetramethyl-2-(3,3,3-trifluoropropyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 154128105) has the molecular formula C7H19F3O4Si4 and a molecular weight of 336.56 g/mol. Its IUPAC name is 2,4,6,8-tetramethyl-2-(3,3,3-trifluoropropyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,4,6,8-tetramethyl-2-(3,3,3-trifluoropropyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 154128105 |
| Molecular Formula | C7H19F3O4Si4 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 2,4,6,8-tetramethyl-2-(3,3,3-trifluoropropyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C[SiH]1O[SiH](C)O[Si](C)(CCC(F)(F)F)O[SiH](C)O1 |
| InChI | InChI=1S/C7H19F3O4Si4/c1-15-11-16(2)13-18(4,14-17(3)12-15)6-5-7(8,9)10/h15-17H,5-6H2,1-4H3 |
| InChIKey | ANOZRMVYNGFWGL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|