C8H26O7Si5 — CID 169041077
2,6-diethoxy-2,4,8,10-tetramethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane (PubChem CID 169041077) has the molecular formula C8H26O7Si5 and a molecular weight of 374.72 g/mol. Its IUPAC name is 2,6-diethoxy-2,4,8,10-tetramethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane.
| Compound Name | 2,6-diethoxy-2,4,8,10-tetramethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
|---|---|
| PubChem CID | 169041077 |
| Molecular Formula | C8H26O7Si5 |
| Molecular Weight | 374.72 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 2,6-diethoxy-2,4,8,10-tetramethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
| SMILES | CCO[SiH]1O[SiH](C)O[SiH](C)O[Si](C)(OCC)O[SiH](C)O1 |
| InChI | InChI=1S/C8H26O7Si5/c1-7-9-19-12-16(3)11-17(4)14-20(6,10-8-2)15-18(5)13-19/h16-19H,7-8H2,1-6H3 |
| InChIKey | JRKOSXHFJVOGJH-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.72 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|