C5H12O3Si — CID 153467726
2-ethoxy-2,4-dimethyl-1,3,2-dioxasiletane (PubChem CID 153467726) has the molecular formula C5H12O3Si and a molecular weight of 148.23 g/mol. Its IUPAC name is 2-ethoxy-2,4-dimethyl-1,3,2-dioxasiletane.
| Compound Name | 2-ethoxy-2,4-dimethyl-1,3,2-dioxasiletane |
|---|---|
| PubChem CID | 153467726 |
| Molecular Formula | C5H12O3Si |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 2-ethoxy-2,4-dimethyl-1,3,2-dioxasiletane |
| SMILES | CCO[Si]1(C)OC(C)O1 |
| InChI | InChI=1S/C5H12O3Si/c1-4-6-9(3)7-5(2)8-9/h5H,4H2,1-3H3 |
| InChIKey | DNJHVCUKXNZRDX-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|