C10H25NO2Si2 — CID 173056549
(2,2-diethoxy-3,3,4-trimethylazasilolidin-1-yl)silane (PubChem CID 173056549) has the molecular formula C10H25NO2Si2 and a molecular weight of 247.49 g/mol. Its IUPAC name is (2,2-diethoxy-3,3,4-trimethylazasilolidin-1-yl)silane.
| Compound Name | (2,2-diethoxy-3,3,4-trimethylazasilolidin-1-yl)silane |
|---|---|
| PubChem CID | 173056549 |
| Molecular Formula | C10H25NO2Si2 |
| Molecular Weight | 247.49 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | (2,2-diethoxy-3,3,4-trimethylazasilolidin-1-yl)silane |
| SMILES | CCO[Si]1(OCC)N([SiH3])CC(C)C1(C)C |
| InChI | InChI=1S/C10H25NO2Si2/c1-6-12-15(13-7-2)10(4,5)9(3)8-11(15)14/h9H,6-8H2,1-5,14H3 |
| InChIKey | OTCJKPBXICGBOY-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.49 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|