C8H18O3Si — CID 67389394
2,2-diethoxy-4-methyloxasilolane (PubChem CID 67389394) has the molecular formula C8H18O3Si and a molecular weight of 190.31 g/mol. Its IUPAC name is 2,2-diethoxy-4-methyloxasilolane.
| Compound Name | 2,2-diethoxy-4-methyloxasilolane |
|---|---|
| PubChem CID | 67389394 |
| Molecular Formula | C8H18O3Si |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 2,2-diethoxy-4-methyloxasilolane |
| SMILES | CCO[Si]1(OCC)CC(C)CO1 |
| InChI | InChI=1S/C8H18O3Si/c1-4-9-12(10-5-2)7-8(3)6-11-12/h8H,4-7H2,1-3H3 |
| InChIKey | WLOQCAPNBCPVES-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|