C10H23NO3Si — CID 140723407
2,2-diethoxy-6-methyl-1,6,2-oxazasilocane (PubChem CID 140723407) has the molecular formula C10H23NO3Si and a molecular weight of 233.38 g/mol. Its IUPAC name is 2,2-diethoxy-6-methyl-1,6,2-oxazasilocane.
| Compound Name | 2,2-diethoxy-6-methyl-1,6,2-oxazasilocane |
|---|---|
| PubChem CID | 140723407 |
| Molecular Formula | C10H23NO3Si |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 2,2-diethoxy-6-methyl-1,6,2-oxazasilocane |
| SMILES | CCO[Si]1(OCC)CCCN(C)CCO1 |
| InChI | InChI=1S/C10H23NO3Si/c1-4-12-15(13-5-2)10-6-7-11(3)8-9-14-15/h4-10H2,1-3H3 |
| InChIKey | ORGPIKKEYCCXGB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|