About 2,2-diethoxy-6-methyl-1,6,2-oxazasilocane
2,2-diethoxy-6-methyl-1,6,2-oxazasilocane (PubChem CID 140723407) has the molecular formula C10H23NO3Si
and a molecular weight of 233.38 g/mol. Its IUPAC name is 2,2-diethoxy-6-methyl-1,6,2-oxazasilocane.
Molecular Properties
| Compound Name | 2,2-diethoxy-6-methyl-1,6,2-oxazasilocane |
| PubChem CID | 140723407 |
| Molecular Formula | C10H23NO3Si |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 2,2-diethoxy-6-methyl-1,6,2-oxazasilocane |
| SMILES | CCO[Si]1(OCC)CCCN(C)CCO1 |
| InChI | InChI=1S/C10H23NO3Si/c1-4-12-15(13-5-2)10-6-7-11(3)8-9-14-15/h4-10H2,1-3H3 |
| InChIKey | ORGPIKKEYCCXGB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diethoxy-6-methyl-1,6,2-oxazasilocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethoxy-6-methyl-1,6,2-oxazasilocane?
The IUPAC name of 2,2-diethoxy-6-methyl-1,6,2-oxazasilocane (CID 140723407) is 2,2-diethoxy-6-methyl-1,6,2-oxazasilocane.
What is the SMILES notation for 2,2-diethoxy-6-methyl-1,6,2-oxazasilocane?
The canonical SMILES for 2,2-diethoxy-6-methyl-1,6,2-oxazasilocane is CCO[Si]1(OCC)CCCN(C)CCO1.
What is the InChIKey of 2,2-diethoxy-6-methyl-1,6,2-oxazasilocane?
The InChIKey is ORGPIKKEYCCXGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO3Si/c1-4-12-15(13-5-2)10-6-7-11(3)8-9-14-15/h4-10H2,1-3H3.
What are the key properties of 2,2-diethoxy-6-methyl-1,6,2-oxazasilocane?
2,2-diethoxy-6-methyl-1,6,2-oxazasilocane has a molecular weight of 233.38 g/mol, XLogP of 1.35, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethoxy-6-methyl-1,6,2-oxazasilocane is sourced from PubChem (CID 140723407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).