C12H27NO3Si — CID 140723416
2,2-diethoxy-8-methyl-1,8,2-oxazasilecane (PubChem CID 140723416) has the molecular formula C12H27NO3Si and a molecular weight of 261.44 g/mol. Its IUPAC name is 2,2-diethoxy-8-methyl-1,8,2-oxazasilecane.
| Compound Name | 2,2-diethoxy-8-methyl-1,8,2-oxazasilecane |
|---|---|
| PubChem CID | 140723416 |
| Molecular Formula | C12H27NO3Si |
| Molecular Weight | 261.44 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 2,2-diethoxy-8-methyl-1,8,2-oxazasilecane |
| SMILES | CCO[Si]1(OCC)CCCCCN(C)CCO1 |
| InChI | InChI=1S/C12H27NO3Si/c1-4-14-17(15-5-2)12-8-6-7-9-13(3)10-11-16-17/h4-12H2,1-3H3 |
| InChIKey | DXOOHLSGURCQPI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|