C10H23NO2Si — CID 140723491
2-ethoxy-2,7-dimethyl-1,7,2-oxazasilonane (PubChem CID 140723491) has the molecular formula C10H23NO2Si and a molecular weight of 217.38 g/mol. Its IUPAC name is 2-ethoxy-2,7-dimethyl-1,7,2-oxazasilonane.
| Compound Name | 2-ethoxy-2,7-dimethyl-1,7,2-oxazasilonane |
|---|---|
| PubChem CID | 140723491 |
| Molecular Formula | C10H23NO2Si |
| Molecular Weight | 217.38 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 2-ethoxy-2,7-dimethyl-1,7,2-oxazasilonane |
| SMILES | CCO[Si]1(C)CCCCN(C)CCO1 |
| InChI | InChI=1S/C10H23NO2Si/c1-4-12-14(3)10-6-5-7-11(2)8-9-13-14/h4-10H2,1-3H3 |
| InChIKey | TYGRJJAAMYOSPM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|