C8H20O4Si2 — CID 90308478
2,5-diethoxy-2,5-dimethyl-1,4,2,5-dioxadisilinane (PubChem CID 90308478) has the molecular formula C8H20O4Si2 and a molecular weight of 236.42 g/mol. Its IUPAC name is 2,5-diethoxy-2,5-dimethyl-1,4,2,5-dioxadisilinane.
| Compound Name | 2,5-diethoxy-2,5-dimethyl-1,4,2,5-dioxadisilinane |
|---|---|
| PubChem CID | 90308478 |
| Molecular Formula | C8H20O4Si2 |
| Molecular Weight | 236.42 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 2,5-diethoxy-2,5-dimethyl-1,4,2,5-dioxadisilinane |
| SMILES | CCO[Si]1(C)CO[Si](C)(OCC)CO1 |
| InChI | InChI=1S/C8H20O4Si2/c1-5-9-13(3)7-12-14(4,8-11-13)10-6-2/h5-8H2,1-4H3 |
| InChIKey | FTNSEBJVBMLNFC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.42 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|