C12H26N2O2Si — CID 67980381
3-(2,6-dimethyl-1,3,6,2-dioxazasilocan-2-yl)-N-propylpropan-1-imine (PubChem CID 67980381) has the molecular formula C12H26N2O2Si and a molecular weight of 258.44 g/mol. Its IUPAC name is 3-(2,6-dimethyl-1,3,6,2-dioxazasilocan-2-yl)-N-propylpropan-1-imine.
| Compound Name | 3-(2,6-dimethyl-1,3,6,2-dioxazasilocan-2-yl)-N-propylpropan-1-imine |
|---|---|
| PubChem CID | 67980381 |
| Molecular Formula | C12H26N2O2Si |
| Molecular Weight | 258.44 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 3-(2,6-dimethyl-1,3,6,2-dioxazasilocan-2-yl)-N-propylpropan-1-imine |
| SMILES | CCC/N=C/CC[Si]1(C)OCCN(C)CCO1 |
| InChI | InChI=1S/C12H26N2O2Si/c1-4-6-13-7-5-12-17(3)15-10-8-14(2)9-11-16-17/h7H,4-6,8-12H2,1-3H3/b13-7+ |
| InChIKey | IAJJJGMXOQHFTC-NTUHNPAUSA-N |
| XLogP | 1.91 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|