C12H26O5Si2 — CID 100950891
2,2,7,7-tetraethoxy-3,6-dihydro-1,2,7-oxadisilepine (PubChem CID 100950891) has the molecular formula C12H26O5Si2 and a molecular weight of 306.51 g/mol. Its IUPAC name is 2,2,7,7-tetraethoxy-3,6-dihydro-1,2,7-oxadisilepine.
| Compound Name | 2,2,7,7-tetraethoxy-3,6-dihydro-1,2,7-oxadisilepine |
|---|---|
| PubChem CID | 100950891 |
| Molecular Formula | C12H26O5Si2 |
| Molecular Weight | 306.51 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 2,2,7,7-tetraethoxy-3,6-dihydro-1,2,7-oxadisilepine |
| SMILES | CCO[Si]1(OCC)CC=CC[Si](OCC)(OCC)O1 |
| InChI | InChI=1S/C12H26O5Si2/c1-5-13-18(14-6-2)11-9-10-12-19(17-18,15-7-3)16-8-4/h9-10H,5-8,11-12H2,1-4H3 |
| InChIKey | GUDVQYUVLOJRPW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.51 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|