About 2-(6-chloro-4-methylhex-4-enyl)-2-ethoxy-5-methyl-1,3,2-dioxasilinane
2-(6-chloro-4-methylhex-4-enyl)-2-ethoxy-5-methyl-1,3,2-dioxasilinane (PubChem CID 66845956) has the molecular formula C13H25ClO3Si
and a molecular weight of 292.88 g/mol. Its IUPAC name is 2-(6-chloro-4-methylhex-4-enyl)-2-ethoxy-5-methyl-1,3,2-dioxasilinane.
Molecular Properties
| Compound Name | 2-(6-chloro-4-methylhex-4-enyl)-2-ethoxy-5-methyl-1,3,2-dioxasilinane |
| PubChem CID | 66845956 |
| Molecular Formula | C13H25ClO3Si |
| Molecular Weight | 292.88 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-(6-chloro-4-methylhex-4-enyl)-2-ethoxy-5-methyl-1,3,2-dioxasilinane |
| SMILES | CCO[Si]1(CCCC(C)=CCCl)OCC(C)CO1 |
| InChI | InChI=1S/C13H25ClO3Si/c1-4-15-18(16-10-13(3)11-17-18)9-5-6-12(2)7-8-14/h7,13H,4-6,8-11H2,1-3H3 |
| InChIKey | XDFFGGIPRKPFJM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.88 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-chloro-4-methylhex-4-enyl)-2-ethoxy-5-methyl-1,3,2-dioxasilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-chloro-4-methylhex-4-enyl)-2-ethoxy-5-methyl-1,3,2-dioxasilinane?
The IUPAC name of 2-(6-chloro-4-methylhex-4-enyl)-2-ethoxy-5-methyl-1,3,2-dioxasilinane (CID 66845956) is 2-(6-chloro-4-methylhex-4-enyl)-2-ethoxy-5-methyl-1,3,2-dioxasilinane.
What is the SMILES notation for 2-(6-chloro-4-methylhex-4-enyl)-2-ethoxy-5-methyl-1,3,2-dioxasilinane?
The canonical SMILES for 2-(6-chloro-4-methylhex-4-enyl)-2-ethoxy-5-methyl-1,3,2-dioxasilinane is CCO[Si]1(CCCC(C)=CCCl)OCC(C)CO1.
What is the InChIKey of 2-(6-chloro-4-methylhex-4-enyl)-2-ethoxy-5-methyl-1,3,2-dioxasilinane?
The InChIKey is XDFFGGIPRKPFJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25ClO3Si/c1-4-15-18(16-10-13(3)11-17-18)9-5-6-12(2)7-8-14/h7,13H,4-6,8-11H2,1-3H3.
What are the key properties of 2-(6-chloro-4-methylhex-4-enyl)-2-ethoxy-5-methyl-1,3,2-dioxasilinane?
2-(6-chloro-4-methylhex-4-enyl)-2-ethoxy-5-methyl-1,3,2-dioxasilinane has a molecular weight of 292.88 g/mol, XLogP of 3.61, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloro-4-methylhex-4-enyl)-2-ethoxy-5-methyl-1,3,2-dioxasilinane is sourced from PubChem (CID 66845956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).