C13H25ClO3Si — CID 66845956
2-(6-chloro-4-methylhex-4-enyl)-2-ethoxy-5-methyl-1,3,2-dioxasilinane (PubChem CID 66845956) has the molecular formula C13H25ClO3Si and a molecular weight of 292.88 g/mol. Its IUPAC name is 2-(6-chloro-4-methylhex-4-enyl)-2-ethoxy-5-methyl-1,3,2-dioxasilinane.
| Compound Name | 2-(6-chloro-4-methylhex-4-enyl)-2-ethoxy-5-methyl-1,3,2-dioxasilinane |
|---|---|
| PubChem CID | 66845956 |
| Molecular Formula | C13H25ClO3Si |
| Molecular Weight | 292.88 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-(6-chloro-4-methylhex-4-enyl)-2-ethoxy-5-methyl-1,3,2-dioxasilinane |
| SMILES | CCO[Si]1(CCCC(C)=CCCl)OCC(C)CO1 |
| InChI | InChI=1S/C13H25ClO3Si/c1-4-15-18(16-10-13(3)11-17-18)9-5-6-12(2)7-8-14/h7,13H,4-6,8-11H2,1-3H3 |
| InChIKey | XDFFGGIPRKPFJM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.88 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|