C10H22BrNO3Si — CID 150976550
2-(3-bromopropyl)-2-ethoxy-6-methyl-1,3,4,2-dioxazasilocane (PubChem CID 150976550) has the molecular formula C10H22BrNO3Si and a molecular weight of 312.28 g/mol. Its IUPAC name is 2-(3-bromopropyl)-2-ethoxy-6-methyl-1,3,4,2-dioxazasilocane.
| Compound Name | 2-(3-bromopropyl)-2-ethoxy-6-methyl-1,3,4,2-dioxazasilocane |
|---|---|
| PubChem CID | 150976550 |
| Molecular Formula | C10H22BrNO3Si |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-(3-bromopropyl)-2-ethoxy-6-methyl-1,3,4,2-dioxazasilocane |
| SMILES | CCO[Si]1(CCCBr)OCCC(C)CNO1 |
| InChI | InChI=1S/C10H22BrNO3Si/c1-3-13-16(8-4-6-11)14-7-5-10(2)9-12-15-16/h10,12H,3-9H2,1-2H3 |
| InChIKey | LPFGVTYAWMFMQS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|