C11H25NO3SSi — CID 151540824
3-(2-ethoxy-6-ethyl-1,3,4,2-dioxazasilocan-2-yl)propane-1-thiol (PubChem CID 151540824) has the molecular formula C11H25NO3SSi and a molecular weight of 279.48 g/mol. Its IUPAC name is 3-(2-ethoxy-6-ethyl-1,3,4,2-dioxazasilocan-2-yl)propane-1-thiol.
| Compound Name | 3-(2-ethoxy-6-ethyl-1,3,4,2-dioxazasilocan-2-yl)propane-1-thiol |
|---|---|
| PubChem CID | 151540824 |
| Molecular Formula | C11H25NO3SSi |
| Molecular Weight | 279.48 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 3-(2-ethoxy-6-ethyl-1,3,4,2-dioxazasilocan-2-yl)propane-1-thiol |
| SMILES | CCO[Si]1(CCCS)OCCC(CC)CNO1 |
| InChI | InChI=1S/C11H25NO3SSi/c1-3-11-6-7-14-17(13-4-2,9-5-8-16)15-12-10-11/h11-12,16H,3-10H2,1-2H3 |
| InChIKey | PYLCDSOGJJXLFA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|