C27H56O7S2Si2 — CID 90712948
S-[3-[2-[3-[(3-hydroxy-2-methylpropoxy)-methyl-(3-sulfanylpropyl)silyl]oxy-2-methylpropoxy]-5-methyl-1,3,2-dioxasilepan-2-yl]propyl] heptanethioate (PubChem CID 90712948) has the molecular formula C27H56O7S2Si2 and a molecular weight of 613.04 g/mol. Its IUPAC name is S-[3-[2-[3-[(3-hydroxy-2-methylpropoxy)-methyl-(3-sulfanylpropyl)silyl]oxy-2-methylpropoxy]-5-methyl-1,3,2-dioxasilepan-2-yl]propyl] heptanethioate.
| Compound Name | S-[3-[2-[3-[(3-hydroxy-2-methylpropoxy)-methyl-(3-sulfanylpropyl)silyl]oxy-2-methylpropoxy]-5-methyl-1,3,2-dioxasilepan-2-yl]propyl] heptanethioate |
|---|---|
| PubChem CID | 90712948 |
| Molecular Formula | C27H56O7S2Si2 |
| Molecular Weight | 613.04 g/mol |
| Exact Mass | 612.30 |
| IUPAC Name | S-[3-[2-[3-[(3-hydroxy-2-methylpropoxy)-methyl-(3-sulfanylpropyl)silyl]oxy-2-methylpropoxy]-5-methyl-1,3,2-dioxasilepan-2-yl]propyl] heptanethioate |
| SMILES | CCCCCCC(=O)SCCC[Si]1(OCC(C)CO[Si](C)(CCCS)OCC(C)CO)OCCC(C)CO1 |
| InChI | InChI=1S/C27H56O7S2Si2/c1-6-7-8-9-12-27(29)36-16-11-18-38(30-14-13-24(2)20-33-38)34-23-26(4)22-32-37(5,17-10-15-35)31-21-25(3)19-28/h24-26,28,35H,6-23H2,1-5H3 |
| InChIKey | UURUPEBZQAXFOB-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.04 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|