C24H51NO7S2Si2 — CID 173047214
3-[(3-hydroxy-2-methylpropoxy)-methyl-[2-methyl-3-[[5-methyl-2-(3-sulfanylpropyl)-1,3,2-dioxasilinan-2-yl]oxy]propoxy]silyl]propyl N-methylsulfanylbutanimidate (PubChem CID 173047214) has the molecular formula C24H51NO7S2Si2 and a molecular weight of 585.98 g/mol. Its IUPAC name is 3-[(3-hydroxy-2-methylpropoxy)-methyl-[2-methyl-3-[[5-methyl-2-(3-sulfanylpropyl)-1,3,2-dioxasilinan-2-yl]oxy]propoxy]silyl]propyl N-methylsulfanylbutanimidate.
| Compound Name | 3-[(3-hydroxy-2-methylpropoxy)-methyl-[2-methyl-3-[[5-methyl-2-(3-sulfanylpropyl)-1,3,2-dioxasilinan-2-yl]oxy]propoxy]silyl]propyl N-methylsulfanylbutanimidate |
|---|---|
| PubChem CID | 173047214 |
| Molecular Formula | C24H51NO7S2Si2 |
| Molecular Weight | 585.98 g/mol |
| Exact Mass | 585.26 |
| IUPAC Name | 3-[(3-hydroxy-2-methylpropoxy)-methyl-[2-methyl-3-[[5-methyl-2-(3-sulfanylpropyl)-1,3,2-dioxasilinan-2-yl]oxy]propoxy]silyl]propyl N-methylsulfanylbutanimidate |
| SMILES | CCCC(=NSC)OCCC[Si](C)(OCC(C)CO)OCC(C)CO[Si]1(CCCS)OCC(C)CO1 |
| InChI | InChI=1S/C24H51NO7S2Si2/c1-7-10-24(25-34-5)27-11-8-13-35(6,28-16-21(2)15-26)29-17-22(3)18-30-36(14-9-12-33)31-19-23(4)20-32-36/h21-23,26,33H,7-20H2,1-6H3 |
| InChIKey | OQSVPJBSQQAJDL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.98 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|