C16H35NO5SSi — CID 150814457
3-[2-[2-(2-butoxyethoxy)ethoxy]-6-methyl-1,3,4,2-dioxazasilocan-2-yl]propane-1-thiol (PubChem CID 150814457) has the molecular formula C16H35NO5SSi and a molecular weight of 381.61 g/mol. Its IUPAC name is 3-[2-[2-(2-butoxyethoxy)ethoxy]-6-methyl-1,3,4,2-dioxazasilocan-2-yl]propane-1-thiol.
| Compound Name | 3-[2-[2-(2-butoxyethoxy)ethoxy]-6-methyl-1,3,4,2-dioxazasilocan-2-yl]propane-1-thiol |
|---|---|
| PubChem CID | 150814457 |
| Molecular Formula | C16H35NO5SSi |
| Molecular Weight | 381.61 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 3-[2-[2-(2-butoxyethoxy)ethoxy]-6-methyl-1,3,4,2-dioxazasilocan-2-yl]propane-1-thiol |
| SMILES | CCCCOCCOCCO[Si]1(CCCS)OCCC(C)CNO1 |
| InChI | InChI=1S/C16H35NO5SSi/c1-3-4-7-18-9-10-19-11-12-21-24(14-5-13-23)20-8-6-16(2)15-17-22-24/h16-17,23H,3-15H2,1-2H3 |
| InChIKey | KIOOACYXJCNOPW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.61 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|