C23H49NO5SSi — CID 150747400
1-[2-[2-(2-butoxyethoxy)ethoxy]-6-methyl-1,3,4,2-dioxazasilocan-2-yl]decane-3-thiol (PubChem CID 150747400) has the molecular formula C23H49NO5SSi and a molecular weight of 479.80 g/mol. Its IUPAC name is 1-[2-[2-(2-butoxyethoxy)ethoxy]-6-methyl-1,3,4,2-dioxazasilocan-2-yl]decane-3-thiol.
| Compound Name | 1-[2-[2-(2-butoxyethoxy)ethoxy]-6-methyl-1,3,4,2-dioxazasilocan-2-yl]decane-3-thiol |
|---|---|
| PubChem CID | 150747400 |
| Molecular Formula | C23H49NO5SSi |
| Molecular Weight | 479.80 g/mol |
| Exact Mass | 479.31 |
| IUPAC Name | 1-[2-[2-(2-butoxyethoxy)ethoxy]-6-methyl-1,3,4,2-dioxazasilocan-2-yl]decane-3-thiol |
| SMILES | CCCCCCCC(S)CC[Si]1(OCCOCCOCCCC)OCCC(C)CNO1 |
| InChI | InChI=1S/C23H49NO5SSi/c1-4-6-8-9-10-11-23(30)13-20-31(27-15-12-22(3)21-24-29-31)28-19-18-26-17-16-25-14-7-5-2/h22-24,30H,4-21H2,1-3H3 |
| InChIKey | JVDIAUPCKCTHCR-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.80 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|