C12H27NO2SSi — CID 150873792
1-(2-ethyl-6-methyl-1,3,4,2-dioxazasilocan-2-yl)pentane-3-thiol (PubChem CID 150873792) has the molecular formula C12H27NO2SSi and a molecular weight of 277.51 g/mol. Its IUPAC name is 1-(2-ethyl-6-methyl-1,3,4,2-dioxazasilocan-2-yl)pentane-3-thiol.
| Compound Name | 1-(2-ethyl-6-methyl-1,3,4,2-dioxazasilocan-2-yl)pentane-3-thiol |
|---|---|
| PubChem CID | 150873792 |
| Molecular Formula | C12H27NO2SSi |
| Molecular Weight | 277.51 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 1-(2-ethyl-6-methyl-1,3,4,2-dioxazasilocan-2-yl)pentane-3-thiol |
| SMILES | CCC(S)CC[Si]1(CC)OCCC(C)CNO1 |
| InChI | InChI=1S/C12H27NO2SSi/c1-4-12(16)7-9-17(5-2)14-8-6-11(3)10-13-15-17/h11-13,16H,4-10H2,1-3H3 |
| InChIKey | KUOVTDCEEKSLQL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|