C8H18O3SSi — CID 151968282
3-(2-ethoxy-1,3,2-dioxasilinan-2-yl)propane-1-thiol (PubChem CID 151968282) has the molecular formula C8H18O3SSi and a molecular weight of 222.38 g/mol. Its IUPAC name is 3-(2-ethoxy-1,3,2-dioxasilinan-2-yl)propane-1-thiol.
| Compound Name | 3-(2-ethoxy-1,3,2-dioxasilinan-2-yl)propane-1-thiol |
|---|---|
| PubChem CID | 151968282 |
| Molecular Formula | C8H18O3SSi |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 3-(2-ethoxy-1,3,2-dioxasilinan-2-yl)propane-1-thiol |
| SMILES | CCO[Si]1(CCCS)OCCCO1 |
| InChI | InChI=1S/C8H18O3SSi/c1-2-9-13(8-4-7-12)10-5-3-6-11-13/h12H,2-8H2,1H3 |
| InChIKey | UADACZGQMLEDQB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|