C10H23NO4Si — CID 151097088
3-(2-methoxy-1,3,6,2-trioxasilocan-2-yl)-N,N-dimethylpropan-1-amine (PubChem CID 151097088) has the molecular formula C10H23NO4Si and a molecular weight of 249.38 g/mol. Its IUPAC name is 3-(2-methoxy-1,3,6,2-trioxasilocan-2-yl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(2-methoxy-1,3,6,2-trioxasilocan-2-yl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 151097088 |
| Molecular Formula | C10H23NO4Si |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 3-(2-methoxy-1,3,6,2-trioxasilocan-2-yl)-N,N-dimethylpropan-1-amine |
| SMILES | CO[Si]1(CCCN(C)C)OCCOCCO1 |
| InChI | InChI=1S/C10H23NO4Si/c1-11(2)5-4-10-16(12-3)14-8-6-13-7-9-15-16/h4-10H2,1-3H3 |
| InChIKey | MNILAKHKELIHRJ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|