C17H36O6SSi2 — CID 87093097
3-[4-methyl-2-[2-[(4-methyl-2-pentyl-1,3,2-dioxasilolan-2-yl)oxy]propoxy]-1,3,2-dioxasilolan-2-yl]propane-1-thiol (PubChem CID 87093097) has the molecular formula C17H36O6SSi2 and a molecular weight of 424.71 g/mol. Its IUPAC name is 3-[4-methyl-2-[2-[(4-methyl-2-pentyl-1,3,2-dioxasilolan-2-yl)oxy]propoxy]-1,3,2-dioxasilolan-2-yl]propane-1-thiol.
| Compound Name | 3-[4-methyl-2-[2-[(4-methyl-2-pentyl-1,3,2-dioxasilolan-2-yl)oxy]propoxy]-1,3,2-dioxasilolan-2-yl]propane-1-thiol |
|---|---|
| PubChem CID | 87093097 |
| Molecular Formula | C17H36O6SSi2 |
| Molecular Weight | 424.71 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 3-[4-methyl-2-[2-[(4-methyl-2-pentyl-1,3,2-dioxasilolan-2-yl)oxy]propoxy]-1,3,2-dioxasilolan-2-yl]propane-1-thiol |
| SMILES | CCCCC[Si]1(OC(C)CO[Si]2(CCCS)OCC(C)O2)OCC(C)O1 |
| InChI | InChI=1S/C17H36O6SSi2/c1-5-6-7-10-26(20-14-17(4)23-26)22-16(3)13-19-25(11-8-9-24)18-12-15(2)21-25/h15-17,24H,5-14H2,1-4H3 |
| InChIKey | YCSNZUMIOCQCFD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.71 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|