C29H62O7SSi2 — CID 87092972
4-[(3-hydroxy-2-methylpropoxy)-[2-methyl-3-[(5-methyl-2-octyl-1,3,2-dioxasilinan-2-yl)oxy]propoxy]-(4-sulfanylbutyl)silyl]-2-methylbutan-1-ol (PubChem CID 87092972) has the molecular formula C29H62O7SSi2 and a molecular weight of 611.05 g/mol. Its IUPAC name is 4-[(3-hydroxy-2-methylpropoxy)-[2-methyl-3-[(5-methyl-2-octyl-1,3,2-dioxasilinan-2-yl)oxy]propoxy]-(4-sulfanylbutyl)silyl]-2-methylbutan-1-ol.
| Compound Name | 4-[(3-hydroxy-2-methylpropoxy)-[2-methyl-3-[(5-methyl-2-octyl-1,3,2-dioxasilinan-2-yl)oxy]propoxy]-(4-sulfanylbutyl)silyl]-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 87092972 |
| Molecular Formula | C29H62O7SSi2 |
| Molecular Weight | 611.05 g/mol |
| Exact Mass | 610.38 |
| IUPAC Name | 4-[(3-hydroxy-2-methylpropoxy)-[2-methyl-3-[(5-methyl-2-octyl-1,3,2-dioxasilinan-2-yl)oxy]propoxy]-(4-sulfanylbutyl)silyl]-2-methylbutan-1-ol |
| SMILES | CCCCCCCC[Si]1(OCC(C)CO[Si](CCCCS)(CCC(C)CO)OCC(C)CO)OCC(C)CO1 |
| InChI | InChI=1S/C29H62O7SSi2/c1-6-7-8-9-10-12-17-39(35-24-29(5)25-36-39)34-23-28(4)22-33-38(16-13-11-15-37,18-14-26(2)19-30)32-21-27(3)20-31/h26-31,37H,6-25H2,1-5H3 |
| InChIKey | LRCZRAXFYSFYRD-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.05 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|