C10H26O6Si3 — CID 174544172
2-butyl-2,4,6-triethoxy-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 174544172) has the molecular formula C10H26O6Si3 and a molecular weight of 326.57 g/mol. Its IUPAC name is 2-butyl-2,4,6-triethoxy-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2-butyl-2,4,6-triethoxy-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 174544172 |
| Molecular Formula | C10H26O6Si3 |
| Molecular Weight | 326.57 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 2-butyl-2,4,6-triethoxy-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | CCCC[Si]1(OCC)O[SiH](OCC)O[SiH](OCC)O1 |
| InChI | InChI=1S/C10H26O6Si3/c1-5-9-10-19(13-8-4)15-17(11-6-2)14-18(16-19)12-7-3/h17-18H,5-10H2,1-4H3 |
| InChIKey | YUAKIHHAQVMRDX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.57 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|