C24H56O4Si4 — CID 142697059
2,4,6,8-tetramethyl-2,4,6,8-tetrapentyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 142697059) has the molecular formula C24H56O4Si4 and a molecular weight of 521.05 g/mol. Its IUPAC name is 2,4,6,8-tetramethyl-2,4,6,8-tetrapentyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,4,6,8-tetramethyl-2,4,6,8-tetrapentyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 142697059 |
| Molecular Formula | C24H56O4Si4 |
| Molecular Weight | 521.05 g/mol |
| Exact Mass | 520.33 |
| IUPAC Name | 2,4,6,8-tetramethyl-2,4,6,8-tetrapentyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CCCCC[Si]1(C)O[Si](C)(CCCCC)O[Si](C)(CCCCC)O[Si](C)(CCCCC)O1 |
| InChI | InChI=1S/C24H56O4Si4/c1-9-13-17-21-29(5)25-30(6,22-18-14-10-2)27-32(8,24-20-16-12-4)28-31(7,26-29)23-19-15-11-3/h9-24H2,1-8H3 |
| InChIKey | MIURUSQMHYEDPT-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.05 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|