C20H54N3O7Si4+3 — CID 22165010
[4-butyl-6,8-bis[diethyl(hydroxy)azaniumyl]-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]-diethyl-hydroxyazanium (PubChem CID 22165010) has the molecular formula C20H54N3O7Si4+3 and a molecular weight of 561.01 g/mol. Its IUPAC name is [4-butyl-6,8-bis[diethyl(hydroxy)azaniumyl]-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]-diethyl-hydroxyazanium.
| Compound Name | [4-butyl-6,8-bis[diethyl(hydroxy)azaniumyl]-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]-diethyl-hydroxyazanium |
|---|---|
| PubChem CID | 22165010 |
| Molecular Formula | C20H54N3O7Si4+3 |
| Molecular Weight | 561.01 g/mol |
| Exact Mass | 560.30 |
| IUPAC Name | [4-butyl-6,8-bis[diethyl(hydroxy)azaniumyl]-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]-diethyl-hydroxyazanium |
| SMILES | CCCC[Si]1(C)O[Si](C)([N+](O)(CC)CC)O[Si](C)([N+](O)(CC)CC)O[Si](C)([N+](O)(CC)CC)O1 |
| InChI | InChI=1S/C20H54N3O7Si4/c1-12-19-20-31(8)27-32(9,21(24,13-2)14-3)29-34(11,23(26,17-6)18-7)30-33(10,28-31)22(25,15-4)16-5/h24-26H,12-20H2,1-11H3/q+3 |
| InChIKey | WQSICRZDSKELFL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.01 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|