C11H31NO4Si4 — CID 20511037
4-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)butan-1-amine (PubChem CID 20511037) has the molecular formula C11H31NO4Si4 and a molecular weight of 353.72 g/mol. Its IUPAC name is 4-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)butan-1-amine.
| Compound Name | 4-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)butan-1-amine |
|---|---|
| PubChem CID | 20511037 |
| Molecular Formula | C11H31NO4Si4 |
| Molecular Weight | 353.72 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 4-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)butan-1-amine |
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si](C)(CCCCN)O[Si](C)(C)O1 |
| InChI | InChI=1S/C11H31NO4Si4/c1-17(2)13-18(3,4)15-20(7,11-9-8-10-12)16-19(5,6)14-17/h8-12H2,1-7H3 |
| InChIKey | DDTPQQFJWDRNKW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.72 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|