C6H19NO5Si4 — CID 123422886
3-(3,5,7-trimethyl-2,4,6,8,9-pentaoxa-1,3,5,7-tetrasilabicyclo[3.3.1]nonan-1-yl)propan-1-amine (PubChem CID 123422886) has the molecular formula C6H19NO5Si4 and a molecular weight of 297.56 g/mol. Its IUPAC name is 3-(3,5,7-trimethyl-2,4,6,8,9-pentaoxa-1,3,5,7-tetrasilabicyclo[3.3.1]nonan-1-yl)propan-1-amine.
| Compound Name | 3-(3,5,7-trimethyl-2,4,6,8,9-pentaoxa-1,3,5,7-tetrasilabicyclo[3.3.1]nonan-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 123422886 |
| Molecular Formula | C6H19NO5Si4 |
| Molecular Weight | 297.56 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 3-(3,5,7-trimethyl-2,4,6,8,9-pentaoxa-1,3,5,7-tetrasilabicyclo[3.3.1]nonan-1-yl)propan-1-amine |
| SMILES | C[SiH]1O[Si]2(C)O[SiH](C)O[Si](CCCN)(O1)O2 |
| InChI | InChI=1S/C6H19NO5Si4/c1-13-8-15(3)9-14(2)11-16(10-13,12-15)6-4-5-7/h13-14H,4-7H2,1-3H3 |
| InChIKey | NVTFHCRYQWCUFA-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.56 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|