C27H65NO12Si7 — CID 69083093
3-[3,7,14-trihydroxy-3,5,7,9,11,14-hexakis(2-methylpropyl)-2,4,6,8,10,12,13,15,16-nonaoxa-1,3,5,7,9,11,14-heptasilatricyclo[7.3.3.15,11]hexadecan-1-yl]propan-1-amine (PubChem CID 69083093) has the molecular formula C27H65NO12Si7 and a molecular weight of 792.41 g/mol. Its IUPAC name is 3-[3,7,14-trihydroxy-3,5,7,9,11,14-hexakis(2-methylpropyl)-2,4,6,8,10,12,13,15,16-nonaoxa-1,3,5,7,9,11,14-heptasilatricyclo[7.3.3.15,11]hexadecan-1-yl]propan-1-amine.
| Compound Name | 3-[3,7,14-trihydroxy-3,5,7,9,11,14-hexakis(2-methylpropyl)-2,4,6,8,10,12,13,15,16-nonaoxa-1,3,5,7,9,11,14-heptasilatricyclo[7.3.3.15,11]hexadecan-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 69083093 |
| Molecular Formula | C27H65NO12Si7 |
| Molecular Weight | 792.41 g/mol |
| Exact Mass | 791.29 |
| IUPAC Name | 3-[3,7,14-trihydroxy-3,5,7,9,11,14-hexakis(2-methylpropyl)-2,4,6,8,10,12,13,15,16-nonaoxa-1,3,5,7,9,11,14-heptasilatricyclo[7.3.3.15,11]hexadecan-1-yl]propan-1-amine |
| SMILES | CC(C)C[Si]1(O)O[Si]2(CCCN)O[Si](O)(CC(C)C)O[Si]3(CC(C)C)O[Si](O)(CC(C)C)O[Si](CC(C)C)(O1)O[Si](CC(C)C)(O2)O3 |
| InChI | InChI=1S/C27H65NO12Si7/c1-22(2)16-41(29)32-44(15-13-14-28)33-42(30,17-23(3)4)35-46(20-26(9)10)37-43(31,18-24(5)6)36-45(34-41,19-25(7)8)39-47(38-44,40-46)21-27(11)12/h22-27,29-31H,13-21,28H2,1-12H3 |
| InChIKey | CBSXTPOAVFUGES-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 169.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|