C14H41NO14Si8 — CID 71078061
3-(5,7,13,15-tetramethoxy-3,5,7,9,11,13,15-heptamethyl-2,4,6,8,10,12,14,16,17,18-decaoxa-1,3,5,7,9,11,13,15-octasilatricyclo[9.5.1.13,9]octadecan-1-yl)propan-1-amine (PubChem CID 71078061) has the molecular formula C14H41NO14Si8 and a molecular weight of 672.16 g/mol. Its IUPAC name is 3-(5,7,13,15-tetramethoxy-3,5,7,9,11,13,15-heptamethyl-2,4,6,8,10,12,14,16,17,18-decaoxa-1,3,5,7,9,11,13,15-octasilatricyclo[9.5.1.13,9]octadecan-1-yl)propan-1-amine.
| Compound Name | 3-(5,7,13,15-tetramethoxy-3,5,7,9,11,13,15-heptamethyl-2,4,6,8,10,12,14,16,17,18-decaoxa-1,3,5,7,9,11,13,15-octasilatricyclo[9.5.1.13,9]octadecan-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 71078061 |
| Molecular Formula | C14H41NO14Si8 |
| Molecular Weight | 672.16 g/mol |
| Exact Mass | 671.07 |
| IUPAC Name | 3-(5,7,13,15-tetramethoxy-3,5,7,9,11,13,15-heptamethyl-2,4,6,8,10,12,14,16,17,18-decaoxa-1,3,5,7,9,11,13,15-octasilatricyclo[9.5.1.13,9]octadecan-1-yl)propan-1-amine |
| SMILES | CO[Si]1(C)O[Si](C)(OC)O[Si]2(C)O[Si](C)(O1)O[Si]1(C)O[Si](C)(OC)O[Si](C)(OC)O[Si](CCCN)(O2)O1 |
| InChI | InChI=1S/C14H41NO14Si8/c1-16-30(5)20-31(6,17-2)23-35(10)25-34(9,22-30)26-36(11)24-32(7,18-3)21-33(8,19-4)27-37(28-35,29-36)14-12-13-15/h12-15H2,1-11H3 |
| InChIKey | MUMRCSFQFNPUQT-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 155.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.16 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|