C11H31NO6Si4 — CID 167539584
3-(2-ethoxy-4-methoxy-4,6,6,8,8-pentamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)propan-1-amine (PubChem CID 167539584) has the molecular formula C11H31NO6Si4 and a molecular weight of 385.71 g/mol. Its IUPAC name is 3-(2-ethoxy-4-methoxy-4,6,6,8,8-pentamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)propan-1-amine.
| Compound Name | 3-(2-ethoxy-4-methoxy-4,6,6,8,8-pentamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 167539584 |
| Molecular Formula | C11H31NO6Si4 |
| Molecular Weight | 385.71 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 3-(2-ethoxy-4-methoxy-4,6,6,8,8-pentamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)propan-1-amine |
| SMILES | CCO[Si]1(CCCN)O[Si](C)(C)O[Si](C)(C)O[Si](C)(OC)O1 |
| InChI | InChI=1S/C11H31NO6Si4/c1-8-14-22(11-9-10-12)17-20(5,6)15-19(3,4)16-21(7,13-2)18-22/h8-12H2,1-7H3 |
| InChIKey | SOWMHCUFBRUBCB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.71 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|