C9H26N2O4Si3 — CID 174098906
N'-[3-(2-hydroxy-4,4,6,6-tetramethyl-1,3,5,2,4,6-trioxatrisilinan-2-yl)propyl]ethane-1,2-diamine (PubChem CID 174098906) has the molecular formula C9H26N2O4Si3 and a molecular weight of 310.58 g/mol. Its IUPAC name is N'-[3-(2-hydroxy-4,4,6,6-tetramethyl-1,3,5,2,4,6-trioxatrisilinan-2-yl)propyl]ethane-1,2-diamine.
| Compound Name | N'-[3-(2-hydroxy-4,4,6,6-tetramethyl-1,3,5,2,4,6-trioxatrisilinan-2-yl)propyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 174098906 |
| Molecular Formula | C9H26N2O4Si3 |
| Molecular Weight | 310.58 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | N'-[3-(2-hydroxy-4,4,6,6-tetramethyl-1,3,5,2,4,6-trioxatrisilinan-2-yl)propyl]ethane-1,2-diamine |
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si](O)(CCCNCCN)O1 |
| InChI | InChI=1S/C9H26N2O4Si3/c1-16(2)13-17(3,4)15-18(12,14-16)9-5-7-11-8-6-10/h11-12H,5-10H2,1-4H3 |
| InChIKey | XOYTZFFGUSZBFQ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.58 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|