C6H16N2O2 — CID 87239429
4-(2-aminoethylamino)butane-1,1-diol (PubChem CID 87239429) has the molecular formula C6H16N2O2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 4-(2-aminoethylamino)butane-1,1-diol.
| Compound Name | 4-(2-aminoethylamino)butane-1,1-diol |
|---|---|
| PubChem CID | 87239429 |
| Molecular Formula | C6H16N2O2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.12 |
| IUPAC Name | 4-(2-aminoethylamino)butane-1,1-diol |
| SMILES | NCCNCCCC(O)O |
| InChI | InChI=1S/C6H16N2O2/c7-3-5-8-4-1-2-6(9)10/h6,8-10H,1-5,7H2 |
| InChIKey | MHTGPSBLSSDIFP-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|