C10H27N5O2 — CID 88677444
1-(2-aminoethylamino)-4-[2-(2-aminoethylamino)ethylamino]butane-2,3-diol (PubChem CID 88677444) has the molecular formula C10H27N5O2 and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-(2-aminoethylamino)-4-[2-(2-aminoethylamino)ethylamino]butane-2,3-diol.
| Compound Name | 1-(2-aminoethylamino)-4-[2-(2-aminoethylamino)ethylamino]butane-2,3-diol |
|---|---|
| PubChem CID | 88677444 |
| Molecular Formula | C10H27N5O2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 1-(2-aminoethylamino)-4-[2-(2-aminoethylamino)ethylamino]butane-2,3-diol |
| SMILES | NCCNCCNCC(O)C(O)CNCCN |
| InChI | InChI=1S/C10H27N5O2/c11-1-3-13-5-6-15-8-10(17)9(16)7-14-4-2-12/h9-10,13-17H,1-8,11-12H2 |
| InChIKey | CUJLYWPWZNSKQF-UHFFFAOYSA-N |
| XLogP | -3.61 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | -3.61 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|