C8H21N3O3 — CID 15327768
3-[2-(2-aminoethylamino)ethylamino]butane-1,2,4-triol (PubChem CID 15327768) has the molecular formula C8H21N3O3 and a molecular weight of 207.27 g/mol. Its IUPAC name is 3-[2-(2-aminoethylamino)ethylamino]butane-1,2,4-triol.
| Compound Name | 3-[2-(2-aminoethylamino)ethylamino]butane-1,2,4-triol |
|---|---|
| PubChem CID | 15327768 |
| Molecular Formula | C8H21N3O3 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 3-[2-(2-aminoethylamino)ethylamino]butane-1,2,4-triol |
| SMILES | NCCNCCNC(CO)C(O)CO |
| InChI | InChI=1S/C8H21N3O3/c9-1-2-10-3-4-11-7(5-12)8(14)6-13/h7-8,10-14H,1-6,9H2 |
| InChIKey | PHXSDBDPHLCSKI-UHFFFAOYSA-N |
| XLogP | -3.16 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|