C5H15N3O2 — CID 91174752
1-amino-2-(2-aminoethylamino)propane-1,3-diol (PubChem CID 91174752) has the molecular formula C5H15N3O2 and a molecular weight of 149.19 g/mol. Its IUPAC name is 1-amino-2-(2-aminoethylamino)propane-1,3-diol.
| Compound Name | 1-amino-2-(2-aminoethylamino)propane-1,3-diol |
|---|---|
| PubChem CID | 91174752 |
| Molecular Formula | C5H15N3O2 |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 1-amino-2-(2-aminoethylamino)propane-1,3-diol |
| SMILES | NCCNC(CO)C(N)O |
| InChI | InChI=1S/C5H15N3O2/c6-1-2-8-4(3-9)5(7)10/h4-5,8-10H,1-3,6-7H2 |
| InChIKey | CNNQTNIBXDHTAQ-UHFFFAOYSA-N |
| XLogP | -2.83 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|