C4H16N4O — CID 87385834
1-N'-(2-aminoethyl)ethane-1,1,2-triamine;hydrate (PubChem CID 87385834) has the molecular formula C4H16N4O and a molecular weight of 136.20 g/mol. Its IUPAC name is 1-N'-(2-aminoethyl)ethane-1,1,2-triamine;hydrate.
| Compound Name | 1-N'-(2-aminoethyl)ethane-1,1,2-triamine;hydrate |
|---|---|
| PubChem CID | 87385834 |
| Molecular Formula | C4H16N4O |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | 1-N'-(2-aminoethyl)ethane-1,1,2-triamine;hydrate |
| SMILES | NCCNC(N)CN.O |
| InChI | InChI=1S/C4H14N4.H2O/c5-1-2-8-4(7)3-6;/h4,8H,1-3,5-7H2;1H2 |
| InChIKey | BDEJMDNGBWAKGJ-UHFFFAOYSA-N |
| XLogP | -3.05 |
| TPSA | 121.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|