C4H15N4Na — CID 174670216
sodium;1-N'-(2-aminoethyl)ethane-1,1,2-triamine;hydride (PubChem CID 174670216) has the molecular formula C4H15N4Na and a molecular weight of 142.18 g/mol. Its IUPAC name is sodium;1-N'-(2-aminoethyl)ethane-1,1,2-triamine;hydride.
| Compound Name | sodium;1-N'-(2-aminoethyl)ethane-1,1,2-triamine;hydride |
|---|---|
| PubChem CID | 174670216 |
| Molecular Formula | C4H15N4Na |
| Molecular Weight | 142.18 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | sodium;1-N'-(2-aminoethyl)ethane-1,1,2-triamine;hydride |
| SMILES | NCCNC(N)CN.[H-].[Na+] |
| InChI | InChI=1S/C4H14N4.Na.H/c5-1-2-8-4(7)3-6;;/h4,8H,1-3,5-7H2;;/q;+1;-1 |
| InChIKey | FVPROPBUPSVKHB-UHFFFAOYSA-N |
| XLogP | -5.11 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.18 |
| LogP ≤ 5 | -5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|