About disodium;1,2-diaminoethanol;hydride
disodium;1,2-diaminoethanol;hydride (PubChem CID 175201156) has the molecular formula C2H10N2Na2O
and a molecular weight of 124.09 g/mol. Its IUPAC name is disodium;1,2-diaminoethanol;hydride.
Molecular Properties
| Compound Name | disodium;1,2-diaminoethanol;hydride |
| PubChem CID | 175201156 |
| Molecular Formula | C2H10N2Na2O |
| Molecular Weight | 124.09 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | disodium;1,2-diaminoethanol;hydride |
| SMILES | NCC(N)O.[H-].[H-].[Na+].[Na+] |
| InChI | InChI=1S/C2H8N2O.2Na.2H/c3-1-2(4)5;;;;/h2,5H,1,3-4H2;;;;/q;2*+1;2*-1 |
| InChIKey | BBWMJMAVLCXKFJ-UHFFFAOYSA-N |
| XLogP | -7.54 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.09 |
| LogP ≤ 5 | -7.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze disodium;1,2-diaminoethanol;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;1,2-diaminoethanol;hydride?
The IUPAC name of disodium;1,2-diaminoethanol;hydride (CID 175201156) is disodium;1,2-diaminoethanol;hydride.
What is the SMILES notation for disodium;1,2-diaminoethanol;hydride?
The canonical SMILES for disodium;1,2-diaminoethanol;hydride is NCC(N)O.[H-].[H-].[Na+].[Na+].
What is the InChIKey of disodium;1,2-diaminoethanol;hydride?
The InChIKey is BBWMJMAVLCXKFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H8N2O.2Na.2H/c3-1-2(4)5;;;;/h2,5H,1,3-4H2;;;;/q;2*+1;2*-1.
What are the key properties of disodium;1,2-diaminoethanol;hydride?
disodium;1,2-diaminoethanol;hydride has a molecular weight of 124.09 g/mol, XLogP of -7.54, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;1,2-diaminoethanol;hydride is sourced from PubChem (CID 175201156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).