About (1S)-1,4,5-triaminopentan-1-ol
(1S)-1,4,5-triaminopentan-1-ol (PubChem CID 88903954) has the molecular formula C5H15N3O
and a molecular weight of 133.19 g/mol. Its IUPAC name is (1S)-1,4,5-triaminopentan-1-ol.
Molecular Properties
| Compound Name | (1S)-1,4,5-triaminopentan-1-ol |
| PubChem CID | 88903954 |
| Molecular Formula | C5H15N3O |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.12 |
| IUPAC Name | (1S)-1,4,5-triaminopentan-1-ol |
| SMILES | NCC(N)CC[C@@H](N)O |
| InChI | InChI=1S/C5H15N3O/c6-3-4(7)1-2-5(8)9/h4-5,9H,1-3,6-8H2/t4?,5-/m0/s1 |
| InChIKey | RMKYEPLAJUMOEV-AKGZTFGVSA-N |
| XLogP | -1.67 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1,4,5-triaminopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1,4,5-triaminopentan-1-ol?
The IUPAC name of (1S)-1,4,5-triaminopentan-1-ol (CID 88903954) is (1S)-1,4,5-triaminopentan-1-ol.
What is the SMILES notation for (1S)-1,4,5-triaminopentan-1-ol?
The canonical SMILES for (1S)-1,4,5-triaminopentan-1-ol is NCC(N)CC[C@@H](N)O.
What is the InChIKey of (1S)-1,4,5-triaminopentan-1-ol?
The InChIKey is RMKYEPLAJUMOEV-AKGZTFGVSA-N. The full InChI is InChI=1S/C5H15N3O/c6-3-4(7)1-2-5(8)9/h4-5,9H,1-3,6-8H2/t4?,5-/m0/s1.
What are the key properties of (1S)-1,4,5-triaminopentan-1-ol?
(1S)-1,4,5-triaminopentan-1-ol has a molecular weight of 133.19 g/mol, XLogP of -1.67, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1,4,5-triaminopentan-1-ol is sourced from PubChem (CID 88903954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).