C5H15N3O — CID 88903954
(1S)-1,4,5-triaminopentan-1-ol (PubChem CID 88903954) has the molecular formula C5H15N3O and a molecular weight of 133.19 g/mol. Its IUPAC name is (1S)-1,4,5-triaminopentan-1-ol.
| Compound Name | (1S)-1,4,5-triaminopentan-1-ol |
|---|---|
| PubChem CID | 88903954 |
| Molecular Formula | C5H15N3O |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.12 |
| IUPAC Name | (1S)-1,4,5-triaminopentan-1-ol |
| SMILES | NCC(N)CC[C@@H](N)O |
| InChI | InChI=1S/C5H15N3O/c6-3-4(7)1-2-5(8)9/h4-5,9H,1-3,6-8H2/t4?,5-/m0/s1 |
| InChIKey | RMKYEPLAJUMOEV-AKGZTFGVSA-N |
| XLogP | -1.67 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|