C5H15N3O — CID 142772966
(3,4-diaminobutylamino)methanol (PubChem CID 142772966) has the molecular formula C5H15N3O and a molecular weight of 133.19 g/mol. Its IUPAC name is (3,4-diaminobutylamino)methanol.
| Compound Name | (3,4-diaminobutylamino)methanol |
|---|---|
| PubChem CID | 142772966 |
| Molecular Formula | C5H15N3O |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.12 |
| IUPAC Name | (3,4-diaminobutylamino)methanol |
| SMILES | NCC(N)CCNCO |
| InChI | InChI=1S/C5H15N3O/c6-3-5(7)1-2-8-4-9/h5,8-9H,1-4,6-7H2 |
| InChIKey | YZRVIPNGGJDFOY-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|