C10H22N4 — CID 101282877
3-[(3,6-diamino-5-methylhexyl)amino]propanenitrile (PubChem CID 101282877) has the molecular formula C10H22N4 and a molecular weight of 198.31 g/mol. Its IUPAC name is 3-[(3,6-diamino-5-methylhexyl)amino]propanenitrile.
| Compound Name | 3-[(3,6-diamino-5-methylhexyl)amino]propanenitrile |
|---|---|
| PubChem CID | 101282877 |
| Molecular Formula | C10H22N4 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | 3-[(3,6-diamino-5-methylhexyl)amino]propanenitrile |
| SMILES | CC(CN)CC(N)CCNCCC#N |
| InChI | InChI=1S/C10H22N4/c1-9(8-12)7-10(13)3-6-14-5-2-4-11/h9-10,14H,2-3,5-8,12-13H2,1H3 |
| InChIKey | OZZGTGWKBSIJOV-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 87.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|