2-(3,3-diaminopropylamino)acetic acid

C5H13N3O2 — CID 150012608

IUPAC2-(3,3-diaminopropylamino)acetic acid
SMILESNC(N)CCNCC(=O)O
InChIInChI=1S/C5H13N3O2/c6-4(7)1-2-8-3-5(9)10/h4,8H,1-3,6-7H2,(H,9,10)
InChIKeyDDPDXGHZSZDITN-UHFFFAOYSA-N
MW147.18 g/mol
LogP-1.71
Rot. Bonds5

About 2-(3,3-diaminopropylamino)acetic acid

2-(3,3-diaminopropylamino)acetic acid (PubChem CID 150012608) has the molecular formula C5H13N3O2 and a molecular weight of 147.18 g/mol. Its IUPAC name is 2-(3,3-diaminopropylamino)acetic acid.

Molecular Properties

Compound Name2-(3,3-diaminopropylamino)acetic acid
PubChem CID150012608
Molecular FormulaC5H13N3O2
Molecular Weight147.18 g/mol
Exact Mass147.10
IUPAC Name2-(3,3-diaminopropylamino)acetic acid
SMILESNC(N)CCNCC(=O)O
InChIInChI=1S/C5H13N3O2/c6-4(7)1-2-8-3-5(9)10/h4,8H,1-3,6-7H2,(H,9,10)
InChIKeyDDPDXGHZSZDITN-UHFFFAOYSA-N
XLogP-1.71
TPSA101.37 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500147.18
LogP ≤ 5-1.71
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 2-(3,3-diaminopropylamino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,3-diaminopropylamino)acetic acid?
The IUPAC name of 2-(3,3-diaminopropylamino)acetic acid (CID 150012608) is 2-(3,3-diaminopropylamino)acetic acid.
What is the SMILES notation for 2-(3,3-diaminopropylamino)acetic acid?
The canonical SMILES for 2-(3,3-diaminopropylamino)acetic acid is NC(N)CCNCC(=O)O.
What is the InChIKey of 2-(3,3-diaminopropylamino)acetic acid?
The InChIKey is DDPDXGHZSZDITN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3O2/c6-4(7)1-2-8-3-5(9)10/h4,8H,1-3,6-7H2,(H,9,10).
What are the key properties of 2-(3,3-diaminopropylamino)acetic acid?
2-(3,3-diaminopropylamino)acetic acid has a molecular weight of 147.18 g/mol, XLogP of -1.71, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-diaminopropylamino)acetic acid is sourced from PubChem (CID 150012608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).