C5H13N3O2 — CID 150012608
2-(3,3-diaminopropylamino)acetic acid (PubChem CID 150012608) has the molecular formula C5H13N3O2 and a molecular weight of 147.18 g/mol. Its IUPAC name is 2-(3,3-diaminopropylamino)acetic acid.
| Compound Name | 2-(3,3-diaminopropylamino)acetic acid |
|---|---|
| PubChem CID | 150012608 |
| Molecular Formula | C5H13N3O2 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 2-(3,3-diaminopropylamino)acetic acid |
| SMILES | NC(N)CCNCC(=O)O |
| InChI | InChI=1S/C5H13N3O2/c6-4(7)1-2-8-3-5(9)10/h4,8H,1-3,6-7H2,(H,9,10) |
| InChIKey | DDPDXGHZSZDITN-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|