About 1-amino-2-silylethanol
1-amino-2-silylethanol (PubChem CID 173493084) has the molecular formula C2H9NOSi
and a molecular weight of 91.19 g/mol. Its IUPAC name is 1-amino-2-silylethanol.
Molecular Properties
| Compound Name | 1-amino-2-silylethanol |
| PubChem CID | 173493084 |
| Molecular Formula | C2H9NOSi |
| Molecular Weight | 91.19 g/mol |
| Exact Mass | 91.05 |
| IUPAC Name | 1-amino-2-silylethanol |
| SMILES | NC(O)C[SiH3] |
| InChI | InChI=1S/C2H9NOSi/c3-2(4)1-5/h2,4H,1,3H2,5H3 |
| InChIKey | XGWQFTDEWITHBO-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 91.19 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-2-silylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2-silylethanol?
The IUPAC name of 1-amino-2-silylethanol (CID 173493084) is 1-amino-2-silylethanol.
What is the SMILES notation for 1-amino-2-silylethanol?
The canonical SMILES for 1-amino-2-silylethanol is NC(O)C[SiH3].
What is the InChIKey of 1-amino-2-silylethanol?
The InChIKey is XGWQFTDEWITHBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H9NOSi/c3-2(4)1-5/h2,4H,1,3H2,5H3.
What are the key properties of 1-amino-2-silylethanol?
1-amino-2-silylethanol has a molecular weight of 91.19 g/mol, XLogP of -1.95, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2-silylethanol is sourced from PubChem (CID 173493084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).