C6H19N5O — CID 57100316
1,3,4,5,6-pentaaminohexan-2-ol (PubChem CID 57100316) has the molecular formula C6H19N5O and a molecular weight of 177.25 g/mol. Its IUPAC name is 1,3,4,5,6-pentaaminohexan-2-ol.
| Compound Name | 1,3,4,5,6-pentaaminohexan-2-ol |
|---|---|
| PubChem CID | 57100316 |
| Molecular Formula | C6H19N5O |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.16 |
| IUPAC Name | 1,3,4,5,6-pentaaminohexan-2-ol |
| SMILES | NCC(N)C(N)C(N)C(O)CN |
| InChI | InChI=1S/C6H19N5O/c7-1-3(9)5(10)6(11)4(12)2-8/h3-6,12H,1-2,7-11H2 |
| InChIKey | TVVIWMRTJIBAQP-UHFFFAOYSA-N |
| XLogP | -3.75 |
| TPSA | 150.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | -3.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |